C15H20F3N3OS — CID 10154714
N-[2-(ethylsulfanylamino)-5-(trifluoromethyl)-3-pyridinyl]cyclohexanecarboxamide (PubChem CID 10154714) has the molecular formula C15H20F3N3OS and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[2-(ethylsulfanylamino)-5-(trifluoromethyl)-3-pyridinyl]cyclohexanecarboxamide.
| Compound Name | N-[2-(ethylsulfanylamino)-5-(trifluoromethyl)-3-pyridinyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 10154714 |
| Molecular Formula | C15H20F3N3OS |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[2-(ethylsulfanylamino)-5-(trifluoromethyl)-3-pyridinyl]cyclohexanecarboxamide |
| SMILES | CCSNc1ncc(C(F)(F)F)cc1NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H20F3N3OS/c1-2-23-21-13-12(8-11(9-19-13)15(16,17)18)20-14(22)10-6-4-3-5-7-10/h8-10H,2-7H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | CQAWFSDDKCMRKW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|