C15H21N3O5S — CID 155470049
5-(cyclohexanecarbonylamino)-6-(ethylsulfonylamino)pyridine-3-carboxylic acid (PubChem CID 155470049) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is 5-(cyclohexanecarbonylamino)-6-(ethylsulfonylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-(cyclohexanecarbonylamino)-6-(ethylsulfonylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 155470049 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 5-(cyclohexanecarbonylamino)-6-(ethylsulfonylamino)pyridine-3-carboxylic acid |
| SMILES | CCS(=O)(=O)Nc1ncc(C(=O)O)cc1NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H21N3O5S/c1-2-24(22,23)18-13-12(8-11(9-16-13)15(20)21)17-14(19)10-6-4-3-5-7-10/h8-10H,2-7H2,1H3,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | MWORKVVELKDLEY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |