C20H22N2O3S — CID 10156018
methyl 3-[(1-amino-3-phenylpropan-2-yl)amino]-5-methoxy-1-benzothiophene-2-carboxylate (PubChem CID 10156018) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is methyl 3-[(1-amino-3-phenylpropan-2-yl)amino]-5-methoxy-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-[(1-amino-3-phenylpropan-2-yl)amino]-5-methoxy-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 10156018 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | methyl 3-[(1-amino-3-phenylpropan-2-yl)amino]-5-methoxy-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccc(OC)cc2c1NC(CN)Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-24-15-8-9-17-16(11-15)18(19(26-17)20(23)25-2)22-14(12-21)10-13-6-4-3-5-7-13/h3-9,11,14,22H,10,12,21H2,1-2H3 |
| InChIKey | KURMEGOXHXFVPY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |