C14H16N2O4S — CID 106112483
methyl 3-[(3-amino-2-methoxypropanoyl)amino]-1-benzothiophene-2-carboxylate (PubChem CID 106112483) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is methyl 3-[(3-amino-2-methoxypropanoyl)amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-[(3-amino-2-methoxypropanoyl)amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 106112483 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl 3-[(3-amino-2-methoxypropanoyl)amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccccc2c1NC(=O)C(CN)OC |
| InChI | InChI=1S/C14H16N2O4S/c1-19-9(7-15)13(17)16-11-8-5-3-4-6-10(8)21-12(11)14(18)20-2/h3-6,9H,7,15H2,1-2H3,(H,16,17) |
| InChIKey | HAAVOYZBRZXRPK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |