C21H21NO5S2 — CID 16837986
methyl 3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 16837986) has the molecular formula C21H21NO5S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is methyl 3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 16837986 |
| Molecular Formula | C21H21NO5S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | methyl 3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccccc2c1NC(=O)Cc1ccc(S(=O)(=O)C(C)C)cc1 |
| InChI | InChI=1S/C21H21NO5S2/c1-13(2)29(25,26)15-10-8-14(9-11-15)12-18(23)22-19-16-6-4-5-7-17(16)28-20(19)21(24)27-3/h4-11,13H,12H2,1-3H3,(H,22,23) |
| InChIKey | ABDRLFMGIRWXJZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |