C20H20N2O5S — CID 16837991
3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]-1-benzofuran-2-carboxamide (PubChem CID 16837991) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16837991 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 3-[[2-(4-propan-2-ylsulfonylphenyl)acetyl]amino]-1-benzofuran-2-carboxamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(CC(=O)Nc2c(C(N)=O)oc3ccccc23)cc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-12(2)28(25,26)14-9-7-13(8-10-14)11-17(23)22-18-15-5-3-4-6-16(15)27-19(18)20(21)24/h3-10,12H,11H2,1-2H3,(H2,21,24)(H,22,23) |
| InChIKey | NXEXVPCZYXUQGX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |