C19H17FN2O5S — CID 18585988
3-[4-(4-fluorophenyl)sulfonylbutanoylamino]-1-benzofuran-2-carboxamide (PubChem CID 18585988) has the molecular formula C19H17FN2O5S and a molecular weight of 404.42 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)sulfonylbutanoylamino]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[4-(4-fluorophenyl)sulfonylbutanoylamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18585988 |
| Molecular Formula | C19H17FN2O5S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-[4-(4-fluorophenyl)sulfonylbutanoylamino]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1oc2ccccc2c1NC(=O)CCCS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O5S/c20-12-7-9-13(10-8-12)28(25,26)11-3-6-16(23)22-17-14-4-1-2-5-15(14)27-18(17)19(21)24/h1-2,4-5,7-10H,3,6,11H2,(H2,21,24)(H,22,23) |
| InChIKey | IMSBQOKUVTZYMQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |