C22H16FN3O5S — CID 16822812
3-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]-1-benzofuran-2-carboxamide (PubChem CID 16822812) has the molecular formula C22H16FN3O5S and a molecular weight of 453.45 g/mol. Its IUPAC name is 3-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16822812 |
| Molecular Formula | C22H16FN3O5S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 3-[[4-[(4-fluorophenyl)sulfonylamino]benzoyl]amino]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1oc2ccccc2c1NC(=O)c1ccc(NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H16FN3O5S/c23-14-7-11-16(12-8-14)32(29,30)26-15-9-5-13(6-10-15)22(28)25-19-17-3-1-2-4-18(17)31-20(19)21(24)27/h1-12,26H,(H2,24,27)(H,25,28) |
| InChIKey | HFCLILUCOXINLL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |