C16H11F3N2O5S — CID 8842704
3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]-1-benzofuran-2-carboxamide (PubChem CID 8842704) has the molecular formula C16H11F3N2O5S and a molecular weight of 400.33 g/mol. Its IUPAC name is 3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8842704 |
| Molecular Formula | C16H11F3N2O5S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 3-[[4-(trifluoromethoxy)phenyl]sulfonylamino]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1oc2ccccc2c1NS(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F3N2O5S/c17-16(18,19)26-9-5-7-10(8-6-9)27(23,24)21-13-11-3-1-2-4-12(11)25-14(13)15(20)22/h1-8,21H,(H2,20,22) |
| InChIKey | QWDPNUPVEQDRDC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |