C15H10Cl2N2O4S — CID 8842675
3-[(2,3-dichlorophenyl)sulfonylamino]-1-benzofuran-2-carboxamide (PubChem CID 8842675) has the molecular formula C15H10Cl2N2O4S and a molecular weight of 385.23 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)sulfonylamino]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(2,3-dichlorophenyl)sulfonylamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8842675 |
| Molecular Formula | C15H10Cl2N2O4S |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)sulfonylamino]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1oc2ccccc2c1NS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl2N2O4S/c16-9-5-3-7-11(12(9)17)24(21,22)19-13-8-4-1-2-6-10(8)23-14(13)15(18)20/h1-7,19H,(H2,18,20) |
| InChIKey | BRXCMWPXCRXCAZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |