C18H11ClN2O3S — CID 3456999
3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-1-benzofuran-2-carboxamide (PubChem CID 3456999) has the molecular formula C18H11ClN2O3S and a molecular weight of 370.82 g/mol. Its IUPAC name is 3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3456999 |
| Molecular Formula | C18H11ClN2O3S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1oc2ccccc2c1NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H11ClN2O3S/c19-13-10-6-2-4-8-12(10)25-16(13)18(23)21-14-9-5-1-3-7-11(9)24-15(14)17(20)22/h1-8H,(H2,20,22)(H,21,23) |
| InChIKey | VCNKPBKXTWEPFH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |