C20H13Cl2NO2S — CID 19782287
N-anthracen-9-yl-2,3-dichlorobenzenesulfonamide (PubChem CID 19782287) has the molecular formula C20H13Cl2NO2S and a molecular weight of 402.30 g/mol. Its IUPAC name is N-anthracen-9-yl-2,3-dichlorobenzenesulfonamide.
| Compound Name | N-anthracen-9-yl-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 19782287 |
| Molecular Formula | C20H13Cl2NO2S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | N-anthracen-9-yl-2,3-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1c2ccccc2cc2ccccc12)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H13Cl2NO2S/c21-17-10-5-11-18(19(17)22)26(24,25)23-20-15-8-3-1-6-13(15)12-14-7-2-4-9-16(14)20/h1-12,23H |
| InChIKey | ZBQMWYVJZUGWIG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|