C21H16Cl2N2O2S — CID 174552416
2,3-dichloro-N-[4-(2-methyl-1H-indol-3-yl)phenyl]benzenesulfonamide (PubChem CID 174552416) has the molecular formula C21H16Cl2N2O2S and a molecular weight of 431.34 g/mol. Its IUPAC name is 2,3-dichloro-N-[4-(2-methyl-1H-indol-3-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[4-(2-methyl-1H-indol-3-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 174552416 |
| Molecular Formula | C21H16Cl2N2O2S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 2,3-dichloro-N-[4-(2-methyl-1H-indol-3-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1[nH]c2ccccc2c1-c1ccc(NS(=O)(=O)c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O2S/c1-13-20(16-5-2-3-7-18(16)24-13)14-9-11-15(12-10-14)25-28(26,27)19-8-4-6-17(22)21(19)23/h2-12,24-25H,1H3 |
| InChIKey | YLVWMGACPTZAPD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |