C23H21N3O3S — CID 163561825
3-[4-[(2,3-dimethylphenyl)sulfonylamino]phenyl]-1H-indole-2-carboxamide (PubChem CID 163561825) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is 3-[4-[(2,3-dimethylphenyl)sulfonylamino]phenyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[4-[(2,3-dimethylphenyl)sulfonylamino]phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 163561825 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 3-[4-[(2,3-dimethylphenyl)sulfonylamino]phenyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccc(-c3c(C(N)=O)[nH]c4ccccc34)cc2)c1C |
| InChI | InChI=1S/C23H21N3O3S/c1-14-6-5-9-20(15(14)2)30(28,29)26-17-12-10-16(11-13-17)21-18-7-3-4-8-19(18)25-22(21)23(24)27/h3-13,25-26H,1-2H3,(H2,24,27) |
| InChIKey | FRVNLDLAZFSMHN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |