C22H17N3O5S — CID 16813614
3-[[2-(benzenesulfonamido)benzoyl]amino]-1-benzofuran-2-carboxamide (PubChem CID 16813614) has the molecular formula C22H17N3O5S and a molecular weight of 435.46 g/mol. Its IUPAC name is 3-[[2-(benzenesulfonamido)benzoyl]amino]-1-benzofuran-2-carboxamide.
| Compound Name | 3-[[2-(benzenesulfonamido)benzoyl]amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 16813614 |
| Molecular Formula | C22H17N3O5S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 3-[[2-(benzenesulfonamido)benzoyl]amino]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1oc2ccccc2c1NC(=O)c1ccccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O5S/c23-21(26)20-19(16-11-5-7-13-18(16)30-20)24-22(27)15-10-4-6-12-17(15)25-31(28,29)14-8-2-1-3-9-14/h1-13,25H,(H2,23,26)(H,24,27) |
| InChIKey | HTSIWMGSYIDWBN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |