C18H14ClNO3S2 — CID 7545545
methyl 3-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 7545545) has the molecular formula C18H14ClNO3S2 and a molecular weight of 391.90 g/mol. Its IUPAC name is methyl 3-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7545545 |
| Molecular Formula | C18H14ClNO3S2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | methyl 3-[[2-(4-chlorophenyl)sulfanylacetyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccccc2c1NC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClNO3S2/c1-23-18(22)17-16(13-4-2-3-5-14(13)25-17)20-15(21)10-24-12-8-6-11(19)7-9-12/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | CMUROWZHGPFPNI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |