C14H15NO4S — CID 79204582
methyl 3-(4-hydroxybutanoylamino)-1-benzothiophene-2-carboxylate (PubChem CID 79204582) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl 3-(4-hydroxybutanoylamino)-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-(4-hydroxybutanoylamino)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 79204582 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | methyl 3-(4-hydroxybutanoylamino)-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccccc2c1NC(=O)CCCO |
| InChI | InChI=1S/C14H15NO4S/c1-19-14(18)13-12(15-11(17)7-4-8-16)9-5-2-3-6-10(9)20-13/h2-3,5-6,16H,4,7-8H2,1H3,(H,15,17) |
| InChIKey | VECKNBATHHMBKP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |