C18H30N6O3 — CID 10156524
6-acetyl-2-[(5R)-5-(dimethylamino)hexyl]-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 10156524) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is 6-acetyl-2-[(5R)-5-(dimethylamino)hexyl]-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-acetyl-2-[(5R)-5-(dimethylamino)hexyl]-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 10156524 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 6-acetyl-2-[(5R)-5-(dimethylamino)hexyl]-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | CC(=O)N1CCN2C1=NC1C2C(=O)N(CCCC[C@@H](C)N(C)C)C(=O)N1C |
| InChI | InChI=1S/C18H30N6O3/c1-12(20(3)4)8-6-7-9-24-16(26)14-15(21(5)18(24)27)19-17-22(13(2)25)10-11-23(14)17/h12,14-15H,6-11H2,1-5H3/t12-,14?,15?/m1/s1 |
| InChIKey | DJXHIVLEVHUDSO-LRVUVFPRSA-N |
| XLogP | 0.23 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|