C25H30FN3O — CID 10158325
(3Z)-6-fluoro-3-[2-[4-(4-piperidin-1-ylbutyl)anilino]ethylidene]-1H-indol-2-one (PubChem CID 10158325) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is (3Z)-6-fluoro-3-[2-[4-(4-piperidin-1-ylbutyl)anilino]ethylidene]-1H-indol-2-one.
| Compound Name | (3Z)-6-fluoro-3-[2-[4-(4-piperidin-1-ylbutyl)anilino]ethylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 10158325 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (3Z)-6-fluoro-3-[2-[4-(4-piperidin-1-ylbutyl)anilino]ethylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2/C1=C/CNc1ccc(CCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C25H30FN3O/c26-20-9-12-22-23(25(30)28-24(22)18-20)13-14-27-21-10-7-19(8-11-21)6-2-5-17-29-15-3-1-4-16-29/h7-13,18,27H,1-6,14-17H2,(H,28,30)/b23-13- |
| InChIKey | FOOXVTHNSIFEPW-QRVIBDJDSA-N |
| XLogP | 5.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|