C20H16N4O4S — CID 10158357
6-(3-hydroxyphenyl)-1-(4-sulfamoylphenyl)indazole-3-carboxamide (PubChem CID 10158357) has the molecular formula C20H16N4O4S and a molecular weight of 408.44 g/mol. Its IUPAC name is 6-(3-hydroxyphenyl)-1-(4-sulfamoylphenyl)indazole-3-carboxamide.
| Compound Name | 6-(3-hydroxyphenyl)-1-(4-sulfamoylphenyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 10158357 |
| Molecular Formula | C20H16N4O4S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 6-(3-hydroxyphenyl)-1-(4-sulfamoylphenyl)indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc(S(N)(=O)=O)cc2)c2cc(-c3cccc(O)c3)ccc12 |
| InChI | InChI=1S/C20H16N4O4S/c21-20(26)19-17-9-4-13(12-2-1-3-15(25)10-12)11-18(17)24(23-19)14-5-7-16(8-6-14)29(22,27)28/h1-11,25H,(H2,21,26)(H2,22,27,28) |
| InChIKey | QXQNVYSARAPWHQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |