C27H29N3O2 — CID 10159579
methyl 7-[(E)-2-(6-carbamimidoylnaphthalen-2-yl)ethenyl]-1-propan-2-yl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 10159579) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is methyl 7-[(E)-2-(6-carbamimidoylnaphthalen-2-yl)ethenyl]-1-propan-2-yl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | methyl 7-[(E)-2-(6-carbamimidoylnaphthalen-2-yl)ethenyl]-1-propan-2-yl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 10159579 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | methyl 7-[(E)-2-(6-carbamimidoylnaphthalen-2-yl)ethenyl]-1-propan-2-yl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc2cc(/C=C/c3ccc4c(c3)C(C(C)C)N(C(=O)OC)CC4)ccc2c1 |
| InChI | InChI=1S/C27H29N3O2/c1-17(2)25-24-15-19(6-8-20(24)12-13-30(25)27(31)32-3)5-4-18-7-9-22-16-23(26(28)29)11-10-21(22)14-18/h4-11,14-17,25H,12-13H2,1-3H3,(H3,28,29)/b5-4+ |
| InChIKey | RYEFEXYXUJWWPL-SNAWJCMRSA-N |
| XLogP | 5.62 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|