C26H29N3 — CID 10271320
6-[2-(1-propan-2-yl-1,2,3,4-tetrahydroisoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide (PubChem CID 10271320) has the molecular formula C26H29N3 and a molecular weight of 383.54 g/mol. Its IUPAC name is 6-[2-(1-propan-2-yl-1,2,3,4-tetrahydroisoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide.
| Compound Name | 6-[2-(1-propan-2-yl-1,2,3,4-tetrahydroisoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 10271320 |
| Molecular Formula | C26H29N3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 6-[2-(1-propan-2-yl-1,2,3,4-tetrahydroisoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C3CC3c3ccc4c(c3)C(C(C)C)NCC4)ccc2c1 |
| InChI | InChI=1S/C26H29N3/c1-15(2)25-24-13-20(6-3-16(24)9-10-29-25)23-14-22(23)19-7-4-18-12-21(26(27)28)8-5-17(18)11-19/h3-8,11-13,15,22-23,25,29H,9-10,14H2,1-2H3,(H3,27,28) |
| InChIKey | IBRFUIAQPHFOQW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|