C32H39N3O — CID 10277586
N'-hydroxy-8-[(E)-3-methylbut-1-enyl]-6-[2-(2-methyl-1-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide (PubChem CID 10277586) has the molecular formula C32H39N3O and a molecular weight of 481.68 g/mol. Its IUPAC name is N'-hydroxy-8-[(E)-3-methylbut-1-enyl]-6-[2-(2-methyl-1-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide.
| Compound Name | N'-hydroxy-8-[(E)-3-methylbut-1-enyl]-6-[2-(2-methyl-1-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 10277586 |
| Molecular Formula | C32H39N3O |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.31 |
| IUPAC Name | N'-hydroxy-8-[(E)-3-methylbut-1-enyl]-6-[2-(2-methyl-1-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide |
| SMILES | CC(C)/C=C/c1cc(C2CC2c2ccc3c(c2)C(C(C)C)N(C)CC3)cc2ccc(/C(N)=N/O)cc12 |
| InChI | InChI=1S/C32H39N3O/c1-19(2)6-7-22-14-26(15-23-10-11-25(17-27(22)23)32(33)34-36)29-18-28(29)24-9-8-21-12-13-35(5)31(20(3)4)30(21)16-24/h6-11,14-17,19-20,28-29,31,36H,12-13,18H2,1-5H3,(H2,33,34)/b7-6+ |
| InChIKey | IILJIWPEUFVUHG-VOTSOKGWSA-N |
| XLogP | 7.06 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|