C30H33N3O — CID 10195171
8-[(E)-3-methoxyprop-1-enyl]-6-[2-(1-propan-2-yl-3,4-dihydroisoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide (PubChem CID 10195171) has the molecular formula C30H33N3O and a molecular weight of 451.61 g/mol. Its IUPAC name is 8-[(E)-3-methoxyprop-1-enyl]-6-[2-(1-propan-2-yl-3,4-dihydroisoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide.
| Compound Name | 8-[(E)-3-methoxyprop-1-enyl]-6-[2-(1-propan-2-yl-3,4-dihydroisoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 10195171 |
| Molecular Formula | C30H33N3O |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 8-[(E)-3-methoxyprop-1-enyl]-6-[2-(1-propan-2-yl-3,4-dihydroisoquinolin-7-yl)cyclopropyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C3CC3c3ccc4c(c3)C(C(C)C)=NCC4)cc(/C=C/COC)c2c1 |
| InChI | InChI=1S/C30H33N3O/c1-18(2)29-28-15-22(7-6-19(28)10-11-33-29)26-17-27(26)24-13-20(5-4-12-34-3)25-16-23(30(31)32)9-8-21(25)14-24/h4-9,13-16,18,26-27H,10-12,17H2,1-3H3,(H3,31,32)/b5-4+ |
| InChIKey | AZSOOHAYAVTJHF-SNAWJCMRSA-N |
| XLogP | 6.06 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|