C28H34N2O4 — CID 10161812
(3R)-4-[(E)-2-[5-[2-[(E)-ethoxyiminomethyl]phenyl]-2-pyridinyl]ethenyl]-5-ethyl-7a-hydroxy-3,6-dimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 10161812) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is (3R)-4-[(E)-2-[5-[2-[(E)-ethoxyiminomethyl]phenyl]-2-pyridinyl]ethenyl]-5-ethyl-7a-hydroxy-3,6-dimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (3R)-4-[(E)-2-[5-[2-[(E)-ethoxyiminomethyl]phenyl]-2-pyridinyl]ethenyl]-5-ethyl-7a-hydroxy-3,6-dimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 10161812 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (3R)-4-[(E)-2-[5-[2-[(E)-ethoxyiminomethyl]phenyl]-2-pyridinyl]ethenyl]-5-ethyl-7a-hydroxy-3,6-dimethyl-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | CCO/N=C/c1ccccc1-c1ccc(/C=C/C2C(CC)C(C)CC3(O)C(=O)OC(C)C23)nc1 |
| InChI | InChI=1S/C28H34N2O4/c1-5-23-18(3)15-28(32)26(19(4)34-27(28)31)25(23)14-13-22-12-11-21(16-29-22)24-10-8-7-9-20(24)17-30-33-6-2/h7-14,16-19,23,25-26,32H,5-6,15H2,1-4H3/b14-13+,30-17+ |
| InChIKey | UFPBXKRGRDVVOC-BNNZIYEGSA-N |
| XLogP | 5.11 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|