C23H27N7O2S — CID 10162005
4-(benzotriazol-1-yloxy)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]butan-1-one (PubChem CID 10162005) has the molecular formula C23H27N7O2S and a molecular weight of 465.58 g/mol. Its IUPAC name is 4-(benzotriazol-1-yloxy)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]butan-1-one.
| Compound Name | 4-(benzotriazol-1-yloxy)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]butan-1-one |
|---|---|
| PubChem CID | 10162005 |
| Molecular Formula | C23H27N7O2S |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-(benzotriazol-1-yloxy)-1-[4-(6-ethylthieno[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]butan-1-one |
| SMILES | CCc1cc2c(N3CCCN(C(=O)CCCOn4nnc5ccccc54)CC3)ncnc2s1 |
| InChI | InChI=1S/C23H27N7O2S/c1-2-17-15-18-22(24-16-25-23(18)33-17)29-11-6-10-28(12-13-29)21(31)9-5-14-32-30-20-8-4-3-7-19(20)26-27-30/h3-4,7-8,15-16H,2,5-6,9-14H2,1H3 |
| InChIKey | STSHOJIPHGXMAL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|