C27H40F3N7O2S — CID 142220558
4-[(buta-1,3-dien-2-yldiazenyl)-prop-2-enylamino]oxy-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]butan-1-one;ethane (PubChem CID 142220558) has the molecular formula C27H40F3N7O2S and a molecular weight of 583.73 g/mol. Its IUPAC name is 4-[(buta-1,3-dien-2-yldiazenyl)-prop-2-enylamino]oxy-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]butan-1-one;ethane.
| Compound Name | 4-[(buta-1,3-dien-2-yldiazenyl)-prop-2-enylamino]oxy-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]butan-1-one;ethane |
|---|---|
| PubChem CID | 142220558 |
| Molecular Formula | C27H40F3N7O2S |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 4-[(buta-1,3-dien-2-yldiazenyl)-prop-2-enylamino]oxy-1-[4-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]butan-1-one;ethane |
| SMILES | C=CCN(/N=N/C(=C)C=C)OCCCC(=O)N1CCN(c2ncnc3sc(CC(F)(F)F)cc23)CC1.CC.CC |
| InChI | InChI=1S/C23H28F3N7O2S.2C2H6/c1-4-8-33(30-29-17(3)5-2)35-13-6-7-20(34)31-9-11-32(12-10-31)21-19-14-18(15-23(24,25)26)36-22(19)28-16-27-21;2*1-2/h4-5,14,16H,1-3,6-13,15H2;2*1-2H3/b30-29+;; |
| InChIKey | BTSGSSNBQQOZDM-NFOZGECASA-N |
| XLogP | 6.76 |
| TPSA | 86.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|