C20H15BrN4O4S — CID 1016230
4-[2-[[1-(3-bromophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]pyrrol-1-yl]benzenesulfonamide (PubChem CID 1016230) has the molecular formula C20H15BrN4O4S and a molecular weight of 487.34 g/mol. Its IUPAC name is 4-[2-[[1-(3-bromophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]pyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[2-[[1-(3-bromophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]pyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 1016230 |
| Molecular Formula | C20H15BrN4O4S |
| Molecular Weight | 487.34 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | 4-[2-[[1-(3-bromophenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]pyrrol-1-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cccc2C=C2C(=O)NN(c3cccc(Br)c3)C2=O)cc1 |
| InChI | InChI=1S/C20H15BrN4O4S/c21-13-3-1-4-16(11-13)25-20(27)18(19(26)23-25)12-15-5-2-10-24(15)14-6-8-17(9-7-14)30(22,28)29/h1-12H,(H,23,26)(H2,22,28,29) |
| InChIKey | JFDJMLCOXWQSMX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|