C29H31N3O5S — CID 10165520
(3S)-7-[2-(2-benzamido-1,3-thiazol-5-yl)ethoxy]-2-[(E)-hept-2-enoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 10165520) has the molecular formula C29H31N3O5S and a molecular weight of 533.65 g/mol. Its IUPAC name is (3S)-7-[2-(2-benzamido-1,3-thiazol-5-yl)ethoxy]-2-[(E)-hept-2-enoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3S)-7-[2-(2-benzamido-1,3-thiazol-5-yl)ethoxy]-2-[(E)-hept-2-enoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10165520 |
| Molecular Formula | C29H31N3O5S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | (3S)-7-[2-(2-benzamido-1,3-thiazol-5-yl)ethoxy]-2-[(E)-hept-2-enoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | CCCC/C=C/C(=O)N1Cc2cc(OCCc3cnc(NC(=O)c4ccccc4)s3)ccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C29H31N3O5S/c1-2-3-4-8-11-26(33)32-19-22-16-23(13-12-21(22)17-25(32)28(35)36)37-15-14-24-18-30-29(38-24)31-27(34)20-9-6-5-7-10-20/h5-13,16,18,25H,2-4,14-15,17,19H2,1H3,(H,35,36)(H,30,31,34)/b11-8+/t25-/m0/s1 |
| InChIKey | GCILHUBFCXVCAK-HGJFNOKFSA-N |
| XLogP | 5.10 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|