C29H32N2O5S — CID 68582263
2-hept-2-enoyl-7-[2-(5-methyl-2-phenylsulfanyl-1,3-oxazol-4-yl)ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 68582263) has the molecular formula C29H32N2O5S and a molecular weight of 520.65 g/mol. Its IUPAC name is 2-hept-2-enoyl-7-[2-(5-methyl-2-phenylsulfanyl-1,3-oxazol-4-yl)ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 2-hept-2-enoyl-7-[2-(5-methyl-2-phenylsulfanyl-1,3-oxazol-4-yl)ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 68582263 |
| Molecular Formula | C29H32N2O5S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 2-hept-2-enoyl-7-[2-(5-methyl-2-phenylsulfanyl-1,3-oxazol-4-yl)ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | CCCCC=CC(=O)N1CCc2ccc(OCCc3nc(Sc4ccccc4)oc3C)cc2C1C(=O)O |
| InChI | InChI=1S/C29H32N2O5S/c1-3-4-5-9-12-26(32)31-17-15-21-13-14-22(19-24(21)27(31)28(33)34)35-18-16-25-20(2)36-29(30-25)37-23-10-7-6-8-11-23/h6-14,19,27H,3-5,15-18H2,1-2H3,(H,33,34) |
| InChIKey | GGQLOZKBVCLKFL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|