C31H40N2O5S — CID 91231651
7-[2-[2-(5-tert-butylsulfanylpent-1-enyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 91231651) has the molecular formula C31H40N2O5S and a molecular weight of 552.74 g/mol. Its IUPAC name is 7-[2-[2-(5-tert-butylsulfanylpent-1-enyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 7-[2-[2-(5-tert-butylsulfanylpent-1-enyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 91231651 |
| Molecular Formula | C31H40N2O5S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 7-[2-[2-(5-tert-butylsulfanylpent-1-enyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | CC=CC=CC(=O)N1CCc2ccc(OCCc3nc(C=CCCCSC(C)(C)C)oc3C)cc2C1C(=O)O |
| InChI | InChI=1S/C31H40N2O5S/c1-6-7-9-13-28(34)33-18-16-23-14-15-24(21-25(23)29(33)30(35)36)37-19-17-26-22(2)38-27(32-26)12-10-8-11-20-39-31(3,4)5/h6-7,9-10,12-15,21,29H,8,11,16-20H2,1-5H3,(H,35,36) |
| InChIKey | OZQGNIAIRHJDMN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|