C27H32N2O5 — CID 87676946
2-hexa-2,4-dienoyl-7-[2-[2-[(E)-4-methylpent-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 87676946) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-hexa-2,4-dienoyl-7-[2-[2-[(E)-4-methylpent-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 2-hexa-2,4-dienoyl-7-[2-[2-[(E)-4-methylpent-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 87676946 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-hexa-2,4-dienoyl-7-[2-[2-[(E)-4-methylpent-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | CC=CC=CC(=O)N1CCc2ccc(OCCc3coc(/C=C/CC(C)C)n3)cc2C1C(=O)O |
| InChI | InChI=1S/C27H32N2O5/c1-4-5-6-10-25(30)29-15-13-20-11-12-22(17-23(20)26(29)27(31)32)33-16-14-21-18-34-24(28-21)9-7-8-19(2)3/h4-7,9-12,17-19,26H,8,13-16H2,1-3H3,(H,31,32)/b5-4?,9-7+,10-6? |
| InChIKey | MAWAUSZVHJNTNF-MODRRSEUSA-N |
| XLogP | 5.00 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|