C28H28N2O5S — CID 91410058
2-hexa-2,4-dienoyl-7-[2-[5-methyl-2-(2-thiophen-2-ylethenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 91410058) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-hexa-2,4-dienoyl-7-[2-[5-methyl-2-(2-thiophen-2-ylethenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 2-hexa-2,4-dienoyl-7-[2-[5-methyl-2-(2-thiophen-2-ylethenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 91410058 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 2-hexa-2,4-dienoyl-7-[2-[5-methyl-2-(2-thiophen-2-ylethenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | CC=CC=CC(=O)N1CCc2ccc(OCCc3nc(C=Cc4cccs4)oc3C)cc2C1C(=O)O |
| InChI | InChI=1S/C28H28N2O5S/c1-3-4-5-8-26(31)30-15-13-20-9-10-21(18-23(20)27(30)28(32)33)34-16-14-24-19(2)35-25(29-24)12-11-22-7-6-17-36-22/h3-12,17-18,27H,13-16H2,1-2H3,(H,32,33) |
| InChIKey | JFKRLWMFTZTHCP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|