C29H34N2O5 — CID 91049503
7-[2-[2-(2-cyclohexylethenyl)-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 91049503) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is 7-[2-[2-(2-cyclohexylethenyl)-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 7-[2-[2-(2-cyclohexylethenyl)-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 91049503 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 7-[2-[2-(2-cyclohexylethenyl)-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | CC=CC=CC(=O)N1CCc2ccc(OCCc3coc(C=CC4CCCCC4)n3)cc2C1C(=O)O |
| InChI | InChI=1S/C29H34N2O5/c1-2-3-5-10-27(32)31-17-15-22-12-13-24(19-25(22)28(31)29(33)34)35-18-16-23-20-36-26(30-23)14-11-21-8-6-4-7-9-21/h2-3,5,10-14,19-21,28H,4,6-9,15-18H2,1H3,(H,33,34) |
| InChIKey | KEFMZYKYHUBFTA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|