C28H34N2O5 — CID 10299366
(3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[2-[(E)-5-methylhex-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 10299366) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[2-[(E)-5-methylhex-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[2-[(E)-5-methylhex-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10299366 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[2-[(E)-5-methylhex-1-enyl]-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | C/C=C/C=C/C(=O)N1Cc2cc(OCCc3coc(/C=C/CCC(C)C)n3)ccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C28H34N2O5/c1-4-5-6-11-27(31)30-18-22-16-24(13-12-21(22)17-25(30)28(32)33)34-15-14-23-19-35-26(29-23)10-8-7-9-20(2)3/h4-6,8,10-13,16,19-20,25H,7,9,14-15,17-18H2,1-3H3,(H,32,33)/b5-4+,10-8+,11-6+/t25-/m0/s1 |
| InChIKey | SAPXSAKXCAURCF-OKQADQEBSA-N |
| XLogP | 5.22 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|