C30H33N3O5 — CID 10301400
(3S)-7-[2-[2-[4-(dimethylamino)phenyl]-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-[(2E,4E)-hexa-2,4-dienoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 10301400) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is (3S)-7-[2-[2-[4-(dimethylamino)phenyl]-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-[(2E,4E)-hexa-2,4-dienoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3S)-7-[2-[2-[4-(dimethylamino)phenyl]-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-[(2E,4E)-hexa-2,4-dienoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10301400 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | (3S)-7-[2-[2-[4-(dimethylamino)phenyl]-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-[(2E,4E)-hexa-2,4-dienoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | C/C=C/C=C/C(=O)N1Cc2cc(OCCc3nc(-c4ccc(N(C)C)cc4)oc3C)ccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C30H33N3O5/c1-5-6-7-8-28(34)33-19-23-17-25(14-11-22(23)18-27(33)30(35)36)37-16-15-26-20(2)38-29(31-26)21-9-12-24(13-10-21)32(3)4/h5-14,17,27H,15-16,18-19H2,1-4H3,(H,35,36)/b6-5+,8-7+/t27-/m0/s1 |
| InChIKey | GCKQALZJOOWVFG-XOZCBKRKSA-N |
| XLogP | 4.81 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|