C28H29N3O5 — CID 87971510
7-[2-[2-(4-aminophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 87971510) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is 7-[2-[2-(4-aminophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 7-[2-[2-(4-aminophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 87971510 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 7-[2-[2-(4-aminophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | CC=CC=CC(=O)N1CCc2ccc(OCCc3nc(-c4ccc(N)cc4)oc3C)cc2C1C(=O)O |
| InChI | InChI=1S/C28H29N3O5/c1-3-4-5-6-25(32)31-15-13-19-9-12-22(17-23(19)26(31)28(33)34)35-16-14-24-18(2)36-27(30-24)20-7-10-21(29)11-8-20/h3-12,17,26H,13-16,29H2,1-2H3,(H,33,34) |
| InChIKey | HZPFUYPLCXKCRP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|