C30H36N2O5 — CID 72831427
7-[2-[2-(2-cyclohexylethenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 72831427) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is 7-[2-[2-(2-cyclohexylethenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 7-[2-[2-(2-cyclohexylethenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 72831427 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 7-[2-[2-(2-cyclohexylethenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]-2-hexa-2,4-dienoyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | CC=CC=CC(=O)N1CCc2ccc(OCCc3nc(C=CC4CCCCC4)oc3C)cc2C1C(=O)O |
| InChI | InChI=1S/C30H36N2O5/c1-3-4-6-11-28(33)32-18-16-23-13-14-24(20-25(23)29(32)30(34)35)36-19-17-26-21(2)37-27(31-26)15-12-22-9-7-5-8-10-22/h3-4,6,11-15,20,22,29H,5,7-10,16-19H2,1-2H3,(H,34,35) |
| InChIKey | LYVUVCYRYFWMHL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|