C29H29N3O7 — CID 10280074
(3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-(2-methyl-4-nitrophenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 10280074) has the molecular formula C29H29N3O7 and a molecular weight of 531.57 g/mol. Its IUPAC name is (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-(2-methyl-4-nitrophenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-(2-methyl-4-nitrophenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10280074 |
| Molecular Formula | C29H29N3O7 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | (3S)-2-[(2E,4E)-hexa-2,4-dienoyl]-7-[2-[5-methyl-2-(2-methyl-4-nitrophenyl)-1,3-oxazol-4-yl]ethoxy]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | C/C=C/C=C/C(=O)N1Cc2cc(OCCc3nc(-c4ccc([N+](=O)[O-])cc4C)oc3C)ccc2C[C@H]1C(=O)O |
| InChI | InChI=1S/C29H29N3O7/c1-4-5-6-7-27(33)31-17-21-15-23(10-8-20(21)16-26(31)29(34)35)38-13-12-25-19(3)39-28(30-25)24-11-9-22(32(36)37)14-18(24)2/h4-11,14-15,26H,12-13,16-17H2,1-3H3,(H,34,35)/b5-4+,7-6+/t26-/m0/s1 |
| InChIKey | INQWPQGHRCIBLN-FVAFEKCRSA-N |
| XLogP | 4.96 |
| TPSA | 136.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|