C21H23NO5 — CID 119195898
2-[3-(3-methoxypropoxy)benzoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 119195898) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[3-(3-methoxypropoxy)benzoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 2-[3-(3-methoxypropoxy)benzoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 119195898 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[3-(3-methoxypropoxy)benzoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | COCCCOc1cccc(C(=O)N2Cc3ccccc3CC2C(=O)O)c1 |
| InChI | InChI=1S/C21H23NO5/c1-26-10-5-11-27-18-9-4-8-16(12-18)20(23)22-14-17-7-3-2-6-15(17)13-19(22)21(24)25/h2-4,6-9,12,19H,5,10-11,13-14H2,1H3,(H,24,25) |
| InChIKey | HBWCZVIJJWSEAB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|