C34H48N2O4 — CID 10166078
octyl 3-[4-cyano-3-[(2R)-3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]phenyl]propanoate (PubChem CID 10166078) has the molecular formula C34H48N2O4 and a molecular weight of 548.77 g/mol. Its IUPAC name is octyl 3-[4-cyano-3-[(2R)-3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]phenyl]propanoate.
| Compound Name | octyl 3-[4-cyano-3-[(2R)-3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 10166078 |
| Molecular Formula | C34H48N2O4 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | octyl 3-[4-cyano-3-[(2R)-3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]phenyl]propanoate |
| SMILES | CCCCCCCCOC(=O)CCc1ccc(C#N)c(OC[C@H](O)CNC(C)(C)CC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C34H48N2O4/c1-4-5-6-7-8-11-18-39-33(38)17-15-26-14-16-30(23-35)32(21-26)40-25-31(37)24-36-34(2,3)22-27-19-28-12-9-10-13-29(28)20-27/h9-10,12-14,16,21,27,31,36-37H,4-8,11,15,17-20,22,24-25H2,1-3H3/t31-/m1/s1 |
| InChIKey | GCLKSISMFRGUIM-WJOKGBTCSA-N |
| XLogP | 6.31 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|