C32H44N2O4 — CID 68634420
ethyl 5-[4-cyano-3-[(2R)-3-[3-(2,3-dihydro-1H-inden-2-ylmethyl)pentan-3-ylamino]-2-hydroxypropoxy]phenyl]pentanoate (PubChem CID 68634420) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is ethyl 5-[4-cyano-3-[(2R)-3-[3-(2,3-dihydro-1H-inden-2-ylmethyl)pentan-3-ylamino]-2-hydroxypropoxy]phenyl]pentanoate.
| Compound Name | ethyl 5-[4-cyano-3-[(2R)-3-[3-(2,3-dihydro-1H-inden-2-ylmethyl)pentan-3-ylamino]-2-hydroxypropoxy]phenyl]pentanoate |
|---|---|
| PubChem CID | 68634420 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | ethyl 5-[4-cyano-3-[(2R)-3-[3-(2,3-dihydro-1H-inden-2-ylmethyl)pentan-3-ylamino]-2-hydroxypropoxy]phenyl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ccc(C#N)c(OC[C@H](O)CNC(CC)(CC)CC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C32H44N2O4/c1-4-32(5-2,20-25-17-26-12-8-9-13-27(26)18-25)34-22-29(35)23-38-30-19-24(15-16-28(30)21-33)11-7-10-14-31(36)37-6-3/h8-9,12-13,15-16,19,25,29,34-35H,4-7,10-11,14,17-18,20,22-23H2,1-3H3/t29-/m1/s1 |
| InChIKey | NVYCBWBXNVZMGW-GDLZYMKVSA-N |
| XLogP | 5.53 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|