C28H36N2O3 — CID 144982050
ethyl 3-[4-cyano-3-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]phenyl]propanoate (PubChem CID 144982050) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is ethyl 3-[4-cyano-3-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]phenyl]propanoate.
| Compound Name | ethyl 3-[4-cyano-3-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 144982050 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | ethyl 3-[4-cyano-3-[3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]propoxy]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(C#N)c(OCCCNC(C)(C)CC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C28H36N2O3/c1-4-32-27(31)13-11-21-10-12-25(20-29)26(18-21)33-15-7-14-30-28(2,3)19-22-16-23-8-5-6-9-24(23)17-22/h5-6,8-10,12,18,22,30H,4,7,11,13-17,19H2,1-3H3 |
| InChIKey | QETXAGSDNNWRGV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|