C26H18Cl5NO5 — CID 10167628
2-benzyl-1-(3,4-dichlorobenzoyl)-5-(2,3,5-trichlorophenyl)pyrrolidine-2,4-dicarboxylic acid (PubChem CID 10167628) has the molecular formula C26H18Cl5NO5 and a molecular weight of 601.70 g/mol. Its IUPAC name is 2-benzyl-1-(3,4-dichlorobenzoyl)-5-(2,3,5-trichlorophenyl)pyrrolidine-2,4-dicarboxylic acid.
| Compound Name | 2-benzyl-1-(3,4-dichlorobenzoyl)-5-(2,3,5-trichlorophenyl)pyrrolidine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 10167628 |
| Molecular Formula | C26H18Cl5NO5 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 598.96 |
| IUPAC Name | 2-benzyl-1-(3,4-dichlorobenzoyl)-5-(2,3,5-trichlorophenyl)pyrrolidine-2,4-dicarboxylic acid |
| SMILES | O=C(O)C1CC(Cc2ccccc2)(C(=O)O)N(C(=O)c2ccc(Cl)c(Cl)c2)C1c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C26H18Cl5NO5/c27-15-9-16(21(31)20(30)10-15)22-17(24(34)35)12-26(25(36)37,11-13-4-2-1-3-5-13)32(22)23(33)14-6-7-18(28)19(29)8-14/h1-10,17,22H,11-12H2,(H,34,35)(H,36,37) |
| InChIKey | CDLVVEFWFRQUOG-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|