C28H29Br2ClN2O3 — CID 10168278
[4,5-dibromo-9-(2-ethoxycarbonylphenyl)-6-(ethylamino)-2,7-dimethylxanthen-3-ylidene]-ethylazanium chloride (PubChem CID 10168278) has the molecular formula C28H29Br2ClN2O3 and a molecular weight of 636.81 g/mol. Its IUPAC name is [4,5-dibromo-9-(2-ethoxycarbonylphenyl)-6-(ethylamino)-2,7-dimethylxanthen-3-ylidene]-ethylazanium chloride.
| Compound Name | [4,5-dibromo-9-(2-ethoxycarbonylphenyl)-6-(ethylamino)-2,7-dimethylxanthen-3-ylidene]-ethylazanium chloride |
|---|---|
| PubChem CID | 10168278 |
| Molecular Formula | C28H29Br2ClN2O3 |
| Molecular Weight | 636.81 g/mol |
| Exact Mass | 634.02 |
| IUPAC Name | [4,5-dibromo-9-(2-ethoxycarbonylphenyl)-6-(ethylamino)-2,7-dimethylxanthen-3-ylidene]-ethylazanium chloride |
| SMILES | CCNc1c(C)cc2c(-c3ccccc3C(=O)OCC)c3cc(C)/c(=[NH+]\CC)c(Br)c-3oc2c1Br.[Cl-] |
| InChI | InChI=1S/C28H28Br2N2O3.ClH/c1-6-31-24-15(4)13-19-21(17-11-9-10-12-18(17)28(33)34-8-3)20-14-16(5)25(32-7-2)23(30)27(20)35-26(19)22(24)29;/h9-14,31H,6-8H2,1-5H3;1H/b32-25+; |
| InChIKey | WXUCHMJBBPEYJJ-MKRHLXOOSA-N |
| XLogP | 2.96 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|