C42H24Br3NaO5 — CID 20606678
sodium 2,5,7-tribromo-9-(2-ethoxycarbonylphenyl)-4-(4-naphthalen-1-ylnaphthalen-1-yl)-6-oxoxanthen-3-olate (PubChem CID 20606678) has the molecular formula C42H24Br3NaO5 and a molecular weight of 871.35 g/mol. Its IUPAC name is sodium 2,5,7-tribromo-9-(2-ethoxycarbonylphenyl)-4-(4-naphthalen-1-ylnaphthalen-1-yl)-6-oxoxanthen-3-olate.
| Compound Name | sodium 2,5,7-tribromo-9-(2-ethoxycarbonylphenyl)-4-(4-naphthalen-1-ylnaphthalen-1-yl)-6-oxoxanthen-3-olate |
|---|---|
| PubChem CID | 20606678 |
| Molecular Formula | C42H24Br3NaO5 |
| Molecular Weight | 871.35 g/mol |
| Exact Mass | 867.91 |
| IUPAC Name | sodium 2,5,7-tribromo-9-(2-ethoxycarbonylphenyl)-4-(4-naphthalen-1-ylnaphthalen-1-yl)-6-oxoxanthen-3-olate |
| SMILES | CCOC(=O)c1ccccc1-c1c2cc(Br)c(=O)c(Br)c-2oc2c(-c3ccc(-c4cccc5ccccc45)c4ccccc34)c([O-])c(Br)cc12.[Na+] |
| InChI | InChI=1S/C42H25Br3O5.Na/c1-2-49-42(48)30-16-8-7-15-28(30)35-31-20-33(43)38(46)36(40(31)50-41-32(35)21-34(44)39(47)37(41)45)29-19-18-27(25-13-5-6-14-26(25)29)24-17-9-11-22-10-3-4-12-23(22)24;/h3-21,46H,2H2,1H3;/q;+1/p-1 |
| InChIKey | AWXNKJKTUTXUNU-UHFFFAOYSA-M |
| XLogP | 8.75 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.35 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|