About 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide
2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide (PubChem CID 160696152) has the molecular formula C25H22Br3N2O5-
and a molecular weight of 670.17 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide |
| PubChem CID | 160696152 |
| Molecular Formula | C25H22Br3N2O5- |
| Molecular Weight | 670.17 g/mol |
| Exact Mass | 666.91 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide |
| SMILES | [Br-].[H]/N=c1\ccc2c(-c3ccccc3C(=O)OCCOCCOC)c3ccc(N)c(Br)c3oc-2c1Br |
| InChI | InChI=1S/C25H22Br2N2O5.BrH/c1-31-10-11-32-12-13-33-25(30)15-5-3-2-4-14(15)20-16-6-8-18(28)21(26)23(16)34-24-17(20)7-9-19(29)22(24)27;/h2-9,28H,10-13,29H2,1H3;1H/p-1/b28-18+; |
| InChIKey | IZMAAQHBTIPXEC-JBQVUESZSA-M |
| XLogP | 2.62 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 670.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide?
The IUPAC name of 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide (CID 160696152) is 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide is [Br-].[H]/N=c1\ccc2c(-c3ccccc3C(=O)OCCOCCOC)c3ccc(N)c(Br)c3oc-2c1Br.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide?
The InChIKey is IZMAAQHBTIPXEC-JBQVUESZSA-M. The full InChI is InChI=1S/C25H22Br2N2O5.BrH/c1-31-10-11-32-12-13-33-25(30)15-5-3-2-4-14(15)20-16-6-8-18(28)21(26)23(16)34-24-17(20)7-9-19(29)22(24)27;/h2-9,28H,10-13,29H2,1H3;1H/p-1/b28-18+;.
What are the key properties of 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide?
2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide has a molecular weight of 670.17 g/mol, XLogP of 2.62, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl 2-(3-amino-4,5-dibromo-6-iminoxanthen-9-yl)benzoate bromide is sourced from PubChem (CID 160696152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).