C32H31NO6 — CID 1017017
methyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 1017017) has the molecular formula C32H31NO6 and a molecular weight of 525.60 g/mol. Its IUPAC name is methyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | methyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1017017 |
| Molecular Formula | C32H31NO6 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | methyl (4R,7R)-7-(3,4-dimethoxyphenyl)-2-methyl-5-oxo-4-(3-phenoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccc(OC)c(OC)c3)C2)[C@H]1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C32H31NO6/c1-19-29(32(35)38-4)30(21-9-8-12-24(15-21)39-23-10-6-5-7-11-23)31-25(33-19)16-22(17-26(31)34)20-13-14-27(36-2)28(18-20)37-3/h5-15,18,22,30,33H,16-17H2,1-4H3/t22-,30+/m1/s1 |
| InChIKey | TVLKHBHGDUHJNK-RCRUUEGKSA-N |
| XLogP | 6.03 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |