About 1-cyanobutylazanium sulfite
1-cyanobutylazanium sulfite (PubChem CID 10171287) has the molecular formula C5H11N2O3S-
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-cyanobutylazanium sulfite.
Molecular Properties
| Compound Name | 1-cyanobutylazanium sulfite |
| PubChem CID | 10171287 |
| Molecular Formula | C5H11N2O3S- |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 1-cyanobutylazanium sulfite |
| SMILES | CCCC([NH3+])C#N.O=S([O-])[O-] |
| InChI | InChI=1S/C5H10N2.H2O3S/c1-2-3-5(7)4-6;1-4(2)3/h5H,2-3,7H2,1H3;(H2,1,2,3)/p-1 |
| InChIKey | NQEVEHJFXPDUJJ-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanobutylazanium sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanobutylazanium sulfite?
The IUPAC name of 1-cyanobutylazanium sulfite (CID 10171287) is 1-cyanobutylazanium sulfite.
What is the SMILES notation for 1-cyanobutylazanium sulfite?
The canonical SMILES for 1-cyanobutylazanium sulfite is CCCC([NH3+])C#N.O=S([O-])[O-].
What is the InChIKey of 1-cyanobutylazanium sulfite?
The InChIKey is NQEVEHJFXPDUJJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10N2.H2O3S/c1-2-3-5(7)4-6;1-4(2)3/h5H,2-3,7H2,1H3;(H2,1,2,3)/p-1.
What are the key properties of 1-cyanobutylazanium sulfite?
1-cyanobutylazanium sulfite has a molecular weight of 179.22 g/mol, XLogP of -1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanobutylazanium sulfite is sourced from PubChem (CID 10171287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).