About 1-cyanoethanesulfinate
1-cyanoethanesulfinate (PubChem CID 57151458) has the molecular formula C3H4NO2S-
and a molecular weight of 118.14 g/mol. Its IUPAC name is 1-cyanoethanesulfinate.
Molecular Properties
| Compound Name | 1-cyanoethanesulfinate |
| PubChem CID | 57151458 |
| Molecular Formula | C3H4NO2S- |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.00 |
| IUPAC Name | 1-cyanoethanesulfinate |
| SMILES | CC(C#N)S(=O)[O-] |
| InChI | InChI=1S/C3H5NO2S/c1-3(2-4)7(5)6/h3H,1H3,(H,5,6)/p-1 |
| InChIKey | WPFZMEYTHVWFDK-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethanesulfinate?
The IUPAC name of 1-cyanoethanesulfinate (CID 57151458) is 1-cyanoethanesulfinate.
What is the SMILES notation for 1-cyanoethanesulfinate?
The canonical SMILES for 1-cyanoethanesulfinate is CC(C#N)S(=O)[O-].
What is the InChIKey of 1-cyanoethanesulfinate?
The InChIKey is WPFZMEYTHVWFDK-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5NO2S/c1-3(2-4)7(5)6/h3H,1H3,(H,5,6)/p-1.
What are the key properties of 1-cyanoethanesulfinate?
1-cyanoethanesulfinate has a molecular weight of 118.14 g/mol, XLogP of -0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethanesulfinate is sourced from PubChem (CID 57151458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).